Difference between revisions of "PWY-7238"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-504 CPD-504] == * common-name: ** a 1-monoglyceride == Reaction(s) known to consume the com...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3723 CPD-3723] == * common-name: ** uridine 2'-monophosphate * smiles: ** c(o)c1(oc(c(op(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-504 CPD-504] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3723 CPD-3723] ==
 
* common-name:
 
* common-name:
** a 1-monoglyceride
+
** uridine 2'-monophosphate
 +
* smiles:
 +
** c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2))
 +
* inchi-key:
 +
** hqidpeytetucnf-xvfcmesisa-l
 +
* molecular-weight:
 +
** 322.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.1.23-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12060]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1-monoglyceride}}
+
{{#set: common-name=uridine 2'-monophosphate}}
 +
{{#set: inchi-key=inchikey=hqidpeytetucnf-xvfcmesisa-l}}
 +
{{#set: molecular-weight=322.168}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-3723

  • common-name:
    • uridine 2'-monophosphate
  • smiles:
    • c(o)c1(oc(c(op(=o)([o-])[o-])c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • hqidpeytetucnf-xvfcmesisa-l
  • molecular-weight:
    • 322.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality