Difference between revisions of "PWY-7242"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYLPHENOL 2-OCTAPRENYLPHENOL] ==
+== Pathway PWY-7242 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 2-octaprenylphenol
+** d-fructuronate degradation
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=cc=cc=1))c)c)c)c)c)c)c)c
+* [[KDPGALDOL-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** vunqjppptjiren-cmaxttdksa-n
+* [NoneMANNONOXIDOREDUCT-RXN MANNONOXIDOREDUCT-RXN]
-* molecular-weight:
+* [NoneMANNONDEHYDRAT-RXN MANNONDEHYDRAT-RXN]
-** 639.058
+* [NoneDEOXYGLUCONOKIN-RXN DEOXYGLUCONOKIN-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
+{{#set: common-name=d-fructuronate degradation}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=2-octaprenylphenol}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
-{{#set: molecular-weight=639.058}}