Difference between revisions of "PWY-7243"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-CYSTEINE D-CYSTEINE] == * common-name: ** d-cysteine * smiles: ** c(s)c(c(=o)[o-])[n+] * inch...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] == * common-name: ** cdp-ethanolamine * smiles: ** c(cop(op(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-CYSTEINE D-CYSTEINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] ==
 
* common-name:
 
* common-name:
** d-cysteine
+
** cdp-ethanolamine
 
* smiles:
 
* smiles:
** c(s)c(c(=o)[o-])[n+]
+
** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
 
* inchi-key:
 
* inchi-key:
** xujnekjlayxesh-uwtatzphsa-n
+
** wvimueuqjfpndk-pebgctimsa-m
 
* molecular-weight:
 
* molecular-weight:
** 121.154
+
** 445.239
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DCYSDESULF-RXN]]
+
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
 +
* [[RXN-17731]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.7.14-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-cysteine}}
+
{{#set: common-name=cdp-ethanolamine}}
{{#set: inchi-key=inchikey=xujnekjlayxesh-uwtatzphsa-n}}
+
{{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}}
{{#set: molecular-weight=121.154}}
+
{{#set: molecular-weight=445.239}}

Revision as of 09:22, 27 August 2019

Metabolite CDP-ETHANOLAMINE

  • common-name:
    • cdp-ethanolamine
  • smiles:
    • c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
  • inchi-key:
    • wvimueuqjfpndk-pebgctimsa-m
  • molecular-weight:
    • 445.239

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality