Difference between revisions of "PWY-7243"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] == * common-name: ** cdp-ethanolamine * smiles: ** c(cop(op(...")
(Created page with "Category:pathway == Pathway PWY-6946 == * taxonomic-range: ** tax-2 * common-name: ** cholesterol degradation to androstenedione ii (cholesterol dehydrogenase) == Reaction...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-ETHANOLAMINE CDP-ETHANOLAMINE] ==
+
== Pathway PWY-6946 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** cdp-ethanolamine
+
** cholesterol degradation to androstenedione ii (cholesterol dehydrogenase)
* smiles:
+
== Reaction(s) found ==
** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
+
* [[RXN-12693]]
* inchi-key:
+
* [[RXN-12705]]
** wvimueuqjfpndk-pebgctimsa-m
+
* [[RXN-12710]]
* molecular-weight:
+
* [[RXN-12848]]
** 445.239
+
* [[RXN-12849]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-12850]]
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
+
== Reaction(s) not found ==
* [[RXN-17731]]
+
* [NoneRXN-17648 RXN-17648]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-17645 RXN-17645]
* [[2.7.7.14-RXN]]
+
* [NoneRXN-12704 RXN-12704]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-12708 RXN-12708]
{{#set: common-name=cdp-ethanolamine}}
+
* [NoneRXN-12745 RXN-12745]
{{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}}
+
* [NoneRXN-17646 RXN-17646]
{{#set: molecular-weight=445.239}}
+
* [NoneRXN-12707 RXN-12707]
 +
* [NoneRXN-12703 RXN-12703]
 +
* [NoneRXN-12743 RXN-12743]
 +
* [NoneRXN-12694 RXN-12694]
 +
* [NoneRXN-17647 RXN-17647]
 +
* [NoneRXN-12744 RXN-12744]
 +
* [NoneRXN-12702 RXN-12702]
 +
* [NoneRXN-12709 RXN-12709]
 +
* [NoneRXN-17650 RXN-17650]
 +
* [NoneRXN-12706 RXN-12706]
 +
{{#set: taxonomic-range=tax-2}}
 +
{{#set: common-name=cholesterol degradation to androstenedione ii (cholesterol dehydrogenase)}}
 +
{{#set: nb reaction found=6}}
 +
{{#set: completion rate=0.27}}
 +
{{#set: nb total reaction=22}}

Revision as of 20:18, 18 December 2020

Pathway PWY-6946

  • taxonomic-range:
    • tax-2
  • common-name:
    • cholesterol degradation to androstenedione ii (cholesterol dehydrogenase)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-17648 RXN-17648]
  • [NoneRXN-17645 RXN-17645]
  • [NoneRXN-12704 RXN-12704]
  • [NoneRXN-12708 RXN-12708]
  • [NoneRXN-12745 RXN-12745]
  • [NoneRXN-17646 RXN-17646]
  • [NoneRXN-12707 RXN-12707]
  • [NoneRXN-12703 RXN-12703]
  • [NoneRXN-12743 RXN-12743]
  • [NoneRXN-12694 RXN-12694]
  • [NoneRXN-17647 RXN-17647]
  • [NoneRXN-12744 RXN-12744]
  • [NoneRXN-12702 RXN-12702]
  • [NoneRXN-12709 RXN-12709]
  • [NoneRXN-17650 RXN-17650]
  • [NoneRXN-12706 RXN-12706]