Difference between revisions of "PWY-7254"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == * common-name: ** (22α)-hydroxy-campest-4-en-3-one * smiles: ** cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] ==
 
* common-name:
 
* common-name:
** uridine
+
** (22α)-hydroxy-campest-4-en-3-one
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** drtqhjpvmgbucf-xvfcmesisa-n
+
** fmfaicdkespfnh-nqmbqapesa-n
 
* molecular-weight:
 
* molecular-weight:
** 244.204
+
** 414.67
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AUPT]]
 
* [[DATUP]]
 
* [[DCTUP]]
 
* [[DGTUP]]
 
* [[DTTUP]]
 
* [[DUTUP]]
 
* [[GTUP]]
 
* [[ITUP]]
 
* [[URIDINE-NUCLEOSIDASE-RXN]]
 
* [[URIDINEKIN-RXN]]
 
* [[URKI-RXN]]
 
* [[URPHOS-RXN]]
 
* [[UTUP]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYTIDEAM2-RXN]]
+
* [[RXN-4231]]
* [[RXN-14025]]
 
* [[UMPP]]
 
* [[URPHOS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine}}
+
{{#set: common-name=(22α)-hydroxy-campest-4-en-3-one}}
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
+
{{#set: inchi-key=inchikey=fmfaicdkespfnh-nqmbqapesa-n}}
{{#set: molecular-weight=244.204}}
+
{{#set: molecular-weight=414.67}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-3945

  • common-name:
    • (22α)-hydroxy-campest-4-en-3-one
  • smiles:
    • cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • fmfaicdkespfnh-nqmbqapesa-n
  • molecular-weight:
    • 414.67

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality