Difference between revisions of "PWY-7274"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HS HS] == * common-name: ** hydrogen sulfide * smiles: ** [sh2] * inchi-key: ** rwsotubldixvet-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] == * common-name: ** (e)-2-benzylidenesuccinyl-coa *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HS HS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] ==
 
* common-name:
 
* common-name:
** hydrogen sulfide
+
** (e)-2-benzylidenesuccinyl-coa
 
* smiles:
 
* smiles:
** [sh2]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** rwsotubldixvet-uhfffaoysa-n
+
** cizckpngzpendv-umuuvtgisa-i
 
* molecular-weight:
 
* molecular-weight:
** 34.076
+
** 950.677
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLHOMOSER-CYS-RXN]]
+
* [[RXN-902]]
* [[ACSERLY-RXN]]
 
* [[RXN-9384]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLHOMOSER-CYS-RXN]]
 
* [[ACSERLY-RXN]]
 
* [[DCYSDESULF-RXN]]
 
* [[HOMOCYSTEINE-DESULFHYDRASE-RXN]]
 
* [[LCYSDESULF-RXN]]
 
* [[MERCAPYSTRANS-RXN]]
 
* [[RXN-15129]]
 
* [[RXN-15148]]
 
* [[RXN-9384]]
 
* [[SULFITE-REDUCT-RXN]]
 
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hydrogen sulfide}}
+
{{#set: common-name=(e)-2-benzylidenesuccinyl-coa}}
{{#set: inchi-key=inchikey=rwsotubldixvet-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=cizckpngzpendv-umuuvtgisa-i}}
{{#set: molecular-weight=34.076}}
+
{{#set: molecular-weight=950.677}}

Revision as of 09:22, 27 August 2019

Metabolite E-PHENYLITACONYL-COA

  • common-name:
    • (e)-2-benzylidenesuccinyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • cizckpngzpendv-umuuvtgisa-i
  • molecular-weight:
    • 950.677

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality