Difference between revisions of "PWY-7274"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] ==
+== Pathway PWY-7274 ==
+* taxonomic-range:
+** tax-2062
 * common-name:
-** (e)-2-benzylidenesuccinyl-coa
+** d-cycloserine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[SERINE-O-ACETTRAN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** cizckpngzpendv-umuuvtgisa-i
+* [NoneRXN-14457 RXN-14457]
-* molecular-weight:
+* [NoneRXN-14459 RXN-14459]
-** 950.677
+* [NoneRXN-14460 RXN-14460]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12537 RXN-12537]
-* [[RXN-902]]
+* [NoneRXN-14458 RXN-14458]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2062}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=d-cycloserine biosynthesis}}
-{{#set: common-name=(e)-2-benzylidenesuccinyl-coa}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=cizckpngzpendv-umuuvtgisa-i}}
+{{#set: completion rate=0.17}}
-{{#set: molecular-weight=950.677}}
+{{#set: nb total reaction=6}}