Difference between revisions of "PWY-7282"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-methyl-terminal-PPK N-methyl-terminal-PPK] == * common-name: ** an n terminal n-methyl-ppk-[p...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9098 CPD-9098] == * common-name: ** geranylgeranyl bacteriopheophytin * smiles: ** ccc1(c(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9098 CPD-9098] == |
* common-name: | * common-name: | ||
| − | ** | + | ** geranylgeranyl bacteriopheophytin |
| + | * smiles: | ||
| + | ** ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c) | ||
| + | * inchi-key: | ||
| + | ** ijmymfmuuouget-riziqltbsa-n | ||
| + | * molecular-weight: | ||
| + | ** 882.173 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17427]] |
| + | * [[RXN-8794]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=geranylgeranyl bacteriopheophytin}} |
| + | {{#set: inchi-key=inchikey=ijmymfmuuouget-riziqltbsa-n}} | ||
| + | {{#set: molecular-weight=882.173}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-9098
- common-name:
- geranylgeranyl bacteriopheophytin
- smiles:
- ccc1(c(c3(n=c1c=c2(nc6(c(=c2c)c([c-](c(c5(=nc(=cc4(nc(c=3)=c(c=4c)c(=o)c))c(c5ccc(=o)occ=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c))=6)c(oc)=o)=o))))c)
- inchi-key:
- ijmymfmuuouget-riziqltbsa-n
- molecular-weight:
- 882.173
