Difference between revisions of "PWY-7283"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C3 C3] == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl...")
(Created page with "Category:pathway == Pathway PWY-7619 == * taxonomic-range: ** tax-2759 * common-name: ** juniperonate biosynthesis == Reaction(s) found == * RXN-12994 * RXN-13001...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C3 C3] ==
+
== Pathway PWY-7619 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine
+
** juniperonate biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(c(=o)nc(c([o-])=o)c)nc(=o)c(cccc[n+])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op(op(occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))([o-])=o)([o-])=o)
+
* [[RXN-12994]]
* inchi-key:
+
* [[RXN-13001]]
** pfmvormcvgoqkr-xncokrrhsa-k
+
* [[RXN-13441]]
* molecular-weight:
+
== Reaction(s) not found ==
** 1146.922
+
* [NoneRXN-12997 RXN-12997]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-11678 RXN-11678]
* [[RXN-8975]]
+
{{#set: taxonomic-range=tax-2759}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=juniperonate biosynthesis}}
* [[RXN-8975]]
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.6}}
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-l-lysyl-d-alanyl-d-alanine}}
+
{{#set: nb total reaction=5}}
{{#set: inchi-key=inchikey=pfmvormcvgoqkr-xncokrrhsa-k}}
 
{{#set: molecular-weight=1146.922}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-7619

  • taxonomic-range:
    • tax-2759
  • common-name:
    • juniperonate biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12997 RXN-12997]
  • [NoneRXN-11678 RXN-11678]