Difference between revisions of "PWY-7285"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] == * common-name: ** 2-formylaminobenzaldehyde * smiles: ** c(c1(c(=cc=cc=1)nc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] ==
 
* common-name:
 
* common-name:
** protoporphyrin ix
+
** 2-formylaminobenzaldehyde
 
* smiles:
 
* smiles:
** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
+
** c(c1(c(=cc=cc=1)nc=o))=o
 
* inchi-key:
 
* inchi-key:
** ksfovussgskxfi-ujjxfscmsa-l
+
** pvimspyddgdctg-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 560.651
+
** 149.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PROTOHEMEFERROCHELAT-RXN]]
 
* [[RXN1F-20]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PPPGO]]
+
* [[INDOLE-23-DIOXYGENASE-RXN]]
* [[PROTOHEMEFERROCHELAT-RXN]]
 
* [[PROTOPORGENOXI-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=protoporphyrin ix}}
+
{{#set: common-name=2-formylaminobenzaldehyde}}
{{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}}
+
{{#set: inchi-key=inchikey=pvimspyddgdctg-uhfffaoysa-n}}
{{#set: molecular-weight=560.651}}
+
{{#set: molecular-weight=149.149}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-248

  • common-name:
    • 2-formylaminobenzaldehyde
  • smiles:
    • c(c1(c(=cc=cc=1)nc=o))=o
  • inchi-key:
    • pvimspyddgdctg-uhfffaoysa-n
  • molecular-weight:
    • 149.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality