Difference between revisions of "PWY-7288"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] ==
+== Pathway PWY-7288 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** 8-amino-7-oxononanoate
+** fatty acid &beta;-oxidation (peroxisome, yeast)
-* smiles:
+== Reaction(s) found ==
-** cc(c(cccccc([o-])=o)=o)[n+]
+* [[ACYLCOASYN-RXN]]
-* inchi-key:
+* [[KETOACYLCOATHIOL-RXN]]
-** guahpajoxvyfon-uhfffaoysa-n
+* [[RXN-11026]]
-* molecular-weight:
+* [[RXN-7699]]
-** 187.238
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN66-485 RXN66-485]
-* [[DAPASYN-RXN]]
+{{#set: taxonomic-range=tax-4751}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=fatty acid &beta;-oxidation (peroxisome, yeast)}}
-* [[7KAPSYN-RXN]]
+{{#set: nb reaction found=4}}
-* [[DAPASYN-RXN]]
+{{#set: completion rate=0.8}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=5}}
-{{#set: common-name=8-amino-7-oxononanoate}}
-{{#set: inchi-key=inchikey=guahpajoxvyfon-uhfffaoysa-n}}
-{{#set: molecular-weight=187.238}}