Difference between revisions of "PWY-7290"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL 2-CARBOXY-D-ARABINITOL] == * common-name: ** 2-carboxy-d-arabinitol * sm...")
(Created page with "Category:pathway == Pathway PWY-7290 == * taxonomic-range: ** tax-1236 * common-name: ** escherichia coli serotype o86 o-antigen biosynthesis == Reaction(s) found == * R...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL 2-CARBOXY-D-ARABINITOL] ==
+
== Pathway PWY-7290 ==
 +
* taxonomic-range:
 +
** tax-1236
 
* common-name:
 
* common-name:
** 2-carboxy-d-arabinitol
+
** escherichia coli serotype o86 o-antigen biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c(c(c(c([o-])=o)(co)o)o)o)o
+
* [[RXN-14561]]
* inchi-key:
+
== Reaction(s) not found ==
** xondrgralztvkd-zmizwqjlsa-m
+
* [NoneRXN-14562 RXN-14562]
* molecular-weight:
+
* [NoneRXN-14560 RXN-14560]
** 195.149
+
* [NoneRXN-14572 RXN-14572]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-14563 RXN-14563]
== Reaction(s) known to produce the compound ==
+
* [NoneGLCNACPTRANS-RXN GLCNACPTRANS-RXN]
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
+
{{#set: taxonomic-range=tax-1236}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=escherichia coli serotype o86 o-antigen biosynthesis}}
{{#set: common-name=2-carboxy-d-arabinitol}}
+
{{#set: nb reaction found=1}}
{{#set: inchi-key=inchikey=xondrgralztvkd-zmizwqjlsa-m}}
+
{{#set: completion rate=0.17}}
{{#set: molecular-weight=195.149}}
+
{{#set: nb total reaction=6}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7290

  • taxonomic-range:
    • tax-1236
  • common-name:
    • escherichia coli serotype o86 o-antigen biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14562 RXN-14562]
  • [NoneRXN-14560 RXN-14560]
  • [NoneRXN-14572 RXN-14572]
  • [NoneRXN-14563 RXN-14563]
  • [NoneGLCNACPTRANS-RXN GLCNACPTRANS-RXN]