Difference between revisions of "PWY-7290"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL 2-CARBOXY-D-ARABINITOL] == * common-name: ** 2-carboxy-d-arabinitol * sm...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] == * common-name: ** gibberellin a12-aldehyde * smiles: ** c=c1(c2(cc3(c1)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL 2-CARBOXY-D-ARABINITOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] ==
 
* common-name:
 
* common-name:
** 2-carboxy-d-arabinitol
+
** gibberellin a12-aldehyde
 
* smiles:
 
* smiles:
** c(c(c(c(c([o-])=o)(co)o)o)o)o
+
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))
 
* inchi-key:
 
* inchi-key:
** xondrgralztvkd-zmizwqjlsa-m
+
** zctunyrxjklwpy-llcokinksa-m
 
* molecular-weight:
 
* molecular-weight:
** 195.149
+
** 315.431
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1F-161]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
+
* [[RXN1F-160]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-carboxy-d-arabinitol}}
+
{{#set: common-name=gibberellin a12-aldehyde}}
{{#set: inchi-key=inchikey=xondrgralztvkd-zmizwqjlsa-m}}
+
{{#set: inchi-key=inchikey=zctunyrxjklwpy-llcokinksa-m}}
{{#set: molecular-weight=195.149}}
+
{{#set: molecular-weight=315.431}}

Revision as of 09:22, 27 August 2019

Metabolite CPD1F-138

  • common-name:
    • gibberellin a12-aldehyde
  • smiles:
    • c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))
  • inchi-key:
    • zctunyrxjklwpy-llcokinksa-m
  • molecular-weight:
    • 315.431

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality