Difference between revisions of "PWY-7291"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE] ==
+== Pathway PWY-7291 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** cis-dienelactone
+** oleate &beta;-oxidation (isomerase-dependent, yeast)
-* smiles:
+== Reaction(s) found ==
-** c1(=cc(=o)oc(=cc(=o)[o-])1)
+* [[RXN-14576]]
-* inchi-key:
+* [[RXN-7931]]
-** ayfxpgxazmfwnh-arjawskdsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-14577 RXN-14577]
-** 139.087
+* [NoneRXN-14575 RXN-14575]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-4751}}
-* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
+{{#set: common-name=oleate &beta;-oxidation (isomerase-dependent, yeast)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.5}}
-{{#set: common-name=cis-dienelactone}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
-{{#set: molecular-weight=139.087}}