Difference between revisions of "PWY-7294"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9872 CPD-9872] ==
+== Pathway PWY-7294 ==
+* taxonomic-range:
+** tax-2157
 * common-name:
-** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol
+** xylose degradation iv
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c
+* [[MALSYN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** glnrsjsltucxtp-iqsnhbbhsa-n
+* [NoneRXN-14642 RXN-14642]
-* molecular-weight:
+* [None4.1.2.28-RXN 4.1.2.28-RXN]
-** 767.229
+* [NoneRXN-14641 RXN-14641]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12246 RXN-12246]
-== Reaction(s) known to produce the compound ==
+* [NoneGLYCOLATE-REDUCTASE-RXN GLYCOLATE-REDUCTASE-RXN]
-* [[RXN-9242]]
+* [NoneXYLONATE-DEHYDRATASE-RXN XYLONATE-DEHYDRATASE-RXN]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2157}}
-{{#set: common-name=6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol}}
+{{#set: common-name=xylose degradation iv}}
-{{#set: inchi-key=inchikey=glnrsjsltucxtp-iqsnhbbhsa-n}}
+{{#set: nb reaction found=1}}
-{{#set: molecular-weight=767.229}}
+{{#set: completion rate=0.14}}
+{{#set: nb total reaction=7}}