Difference between revisions of "PWY-7295"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrohemoglobins Ferrohemoglobins] == * common-name: ** a ferrohemoglobin == Reaction(s) known...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ferrohemoglobins Ferrohemoglobins] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
 
* common-name:
 
* common-name:
** a ferrohemoglobin
+
** quinoxaline-2-carboxyl adenylate
 +
* smiles:
 +
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
 +
* inchi-key:
 +
** vmjweicpcdrxql-scfuhwhpsa-m
 +
* molecular-weight:
 +
** 502.359
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11195]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ferrohemoglobin}}
+
{{#set: common-name=quinoxaline-2-carboxyl adenylate}}
 +
{{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}}
 +
{{#set: molecular-weight=502.359}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-18550

  • common-name:
    • quinoxaline-2-carboxyl adenylate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
  • inchi-key:
    • vmjweicpcdrxql-scfuhwhpsa-m
  • molecular-weight:
    • 502.359

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality