Difference between revisions of "PWY-7297"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] ==
+== Pathway PWY-7297 ==
+* taxonomic-range:
+** tax-33317
+** tax-7735
+** tax-6157
+** tax-7586
 * common-name:
-** crotonyl-coa
+** octopamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
+* [[TYROSINE-DECARBOXYLASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** kfwwcmjsysspsk-bogfjhsmsa-j
+* [NoneRXN-14645 RXN-14645]
-* molecular-weight:
+{{#set: taxonomic-range=tax-7735|tax-6157|tax-7586|tax-33317}}
-** 831.577
+{{#set: common-name=octopamine biosynthesis}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[ACOAD1f]]
+{{#set: completion rate=0.5}}
-* [[ACOAR1h]]
+{{#set: nb total reaction=2}}
-* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
-* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
-* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
-* [[HBCHL]]
-* [[HBCHLm]]
-* [[RXN-11667]]
-* [[RXN-12558]]
-== Reaction(s) known to produce the compound ==
-* [[ACOA40OR]]
-* [[ACOAD1f]]
-* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
-* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
-* [[HBCHL]]
-* [[HBCHLm]]
-* [[RXN-11667]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=crotonyl-coa}}
-{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
-{{#set: molecular-weight=831.577}}