Difference between revisions of "PWY-7303"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
+== Pathway PWY-7303 ==
+* taxonomic-range:
+** tax-2062
 * common-name:
-** cis-coumarinic acid-&beta;-d-glucoside
+** 3-dimethylallyl-4-hydroxybenzoate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(c2(oc(oc1(c=cc=cc=1c=cc(=o)[o-]))c(c(c2o)o)o))o
+* [[PREPHENATEDEHYDROG-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** gvriyimnjgulcz-qlfwqtqqsa-m
+* [NoneRXN-14670 RXN-14670]
-* molecular-weight:
+* [NoneRXN-14631 RXN-14631]
-** 325.294
+* [NoneRXN-14671 RXN-14671]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2062}}
-* [[RXN-8036]]
+{{#set: common-name=3-dimethylallyl-4-hydroxybenzoate biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=cis-coumarinic acid-&beta;-d-glucoside}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=gvriyimnjgulcz-qlfwqtqqsa-m}}
-{{#set: molecular-weight=325.294}}