Difference between revisions of "PWY-7307"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * common-name: ** hydroxybupropion * smiles: ** cc([n+]c(c)(c)co)c(=o)c1(...")
(Created page with "Category:pathway == Pathway PWY-7307 == * taxonomic-range: ** tax-4751 * common-name: ** oleate β-oxidation (reductase-dependent, yeast) == Reaction(s) found == * R...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] ==
+
== Pathway PWY-7307 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** hydroxybupropion
+
** oleate β-oxidation (reductase-dependent, yeast)
* smiles:
+
== Reaction(s) found ==
** cc([n+]c(c)(c)co)c(=o)c1(c=cc=c(cl)c=1)
+
* [[RXN-14715]]
* inchi-key:
+
== Reaction(s) not found ==
** akoaevosdhivfx-uhfffaoysa-o
+
* [NoneRXN-14714 RXN-14714]
* molecular-weight:
+
* [NoneRXN-14716 RXN-14716]
** 256.752
+
{{#set: taxonomic-range=tax-4751}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=oleate β-oxidation (reductase-dependent, yeast)}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN66-181]]
+
{{#set: completion rate=0.33}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=hydroxybupropion}}
 
{{#set: inchi-key=inchikey=akoaevosdhivfx-uhfffaoysa-o}}
 
{{#set: molecular-weight=256.752}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7307

  • taxonomic-range:
    • tax-4751
  • common-name:
    • oleate β-oxidation (reductase-dependent, yeast)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14714 RXN-14714]
  • [NoneRXN-14716 RXN-14716]