Difference between revisions of "PWY-7308"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-193 CPD-193] ==
+== Pathway PWY-7308 ==
+* taxonomic-range:
+** tax-1224
+** tax-201174
 * common-name:
-** d-myo-inositol (4,5)-bisphosphate
+** acrylonitrile degradation i
-* smiles:
+== Reaction(s) found ==
-** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
+* [[R311-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** mckajxmrulsuki-uzaagftcsa-j
+* [NoneR310-RXN R310-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-1224|tax-201174}}
-** 336.085
+{{#set: common-name=acrylonitrile degradation i}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-10948]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-* [[RXN-10948]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=d-myo-inositol (4,5)-bisphosphate}}
-{{#set: inchi-key=inchikey=mckajxmrulsuki-uzaagftcsa-j}}
-{{#set: molecular-weight=336.085}}