Difference between revisions of "PWY-7308"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-193 CPD-193] == * common-name: ** d-myo-inositol (4,5)-bisphosphate * smiles: ** c1(o)(c(o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] == * common-name: ** (2r)-2,3-dihydroxy-3-methylbutanoate * smiles: ** cc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-193 CPD-193] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13357 CPD-13357] ==
 
* common-name:
 
* common-name:
** d-myo-inositol (4,5)-bisphosphate
+
** (2r)-2,3-dihydroxy-3-methylbutanoate
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(o)c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(o)1)
+
** cc(c)(o)c(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** mckajxmrulsuki-uzaagftcsa-j
+
** jteykufkxgdteu-vkhmyheasa-m
 
* molecular-weight:
 
* molecular-weight:
** 336.085
+
** 133.124
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10948]]
+
* [[DIHYDROXYISOVALDEHYDRAT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10948]]
+
* [[ACETOLACTREDUCTOISOM-RXN]]
 +
* [[KARI_LPAREN_23dhmb_RPAREN_]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (4,5)-bisphosphate}}
+
{{#set: common-name=(2r)-2,3-dihydroxy-3-methylbutanoate}}
{{#set: inchi-key=inchikey=mckajxmrulsuki-uzaagftcsa-j}}
+
{{#set: inchi-key=inchikey=jteykufkxgdteu-vkhmyheasa-m}}
{{#set: molecular-weight=336.085}}
+
{{#set: molecular-weight=133.124}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-13357

  • common-name:
    • (2r)-2,3-dihydroxy-3-methylbutanoate
  • smiles:
    • cc(c)(o)c(o)c(=o)[o-]
  • inchi-key:
    • jteykufkxgdteu-vkhmyheasa-m
  • molecular-weight:
    • 133.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality