Difference between revisions of "PWY-7310"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15370 CPD-15370] ==
+== Pathway PWY-6959 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** trans-lesqueroloyl-coa
+** l-ascorbate degradation v
-* smiles:
+== Reaction(s) found ==
-** ccccccc(o)cc=ccccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+* [[RXN-12440]]
-* inchi-key:
+== Reaction(s) not found ==
-** fgrjeqcmqcquqf-fscwmumrsa-j
+* [NoneRXN-12871 RXN-12871]
-* molecular-weight:
+* [NoneRXN-12862 RXN-12862]
-** 1069.99
+* [NoneRXN-12870 RXN-12870]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12861 RXN-12861]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-33090}}
-* [[RXN-14494]]
+{{#set: common-name=l-ascorbate degradation v}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=trans-lesqueroloyl-coa}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=fgrjeqcmqcquqf-fscwmumrsa-j}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=1069.99}}