Difference between revisions of "PWY-7316"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+== Pathway PWY-7316 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 3-oxo-(7z)-tetradecenoyl-coa
+** dtdp-n-acetylviosamine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** bepllrgjvxaeji-twafkmgksa-j
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-* molecular-weight:
+* [NoneRXN-13755 RXN-13755]
-** 985.829
+* [None2.6.1.33-RXN 2.6.1.33-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-17795]]
+{{#set: common-name=dtdp-n-acetylviosamine biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-17794]]
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}}
-{{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}}
-{{#set: molecular-weight=985.829}}