Difference between revisions of "PWY-7318"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CARBOXY-3-HYDROXY-ISOCAPROATE 3-CARBOXY-3-HYDROXY-ISOCAPROATE] ==
+== Pathway PWY-7318 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (2s)-2-isopropylmalate
+** dtdp-3-acetamido-3,6-dideoxy-&alpha;-d-glucose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)c(o)(cc(=o)[o-])c([o-])=o
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** bityxlxucsktjs-zetcqymhsa-l
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-* molecular-weight:
+* [NoneRXN-12840 RXN-12840]
-** 174.153
+* [NoneRXN-14735 RXN-14735]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12810 RXN-12810]
-* [[3-ISOPROPYLMALISOM-RXN]]
+{{#set: taxonomic-range=tax-2}}
-* [[RXN-13163]]
+{{#set: common-name=dtdp-3-acetamido-3,6-dideoxy-&alpha;-d-glucose biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[2-ISOPROPYLMALATESYN-RXN]]
+{{#set: completion rate=0.2}}
-* [[3-ISOPROPYLMALISOM-RXN]]
+{{#set: nb total reaction=5}}
-* [[IPMS]]
-* [[RXN-13163]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(2s)-2-isopropylmalate}}
-{{#set: inchi-key=inchikey=bityxlxucsktjs-zetcqymhsa-l}}
-{{#set: molecular-weight=174.153}}