Difference between revisions of "PWY-7337"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] ==
+== Pathway PWY-7337 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** (e)-2-benzylidenesuccinyl-coa
+** 10-cis-heptadecenoyl-coa degradation (yeast)
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[RXN-14771]]
-* inchi-key:
+* [[RXN-14772]]
-** cizckpngzpendv-umuuvtgisa-i
+* [[RXN-14774]]
-* molecular-weight:
+* [[RXN-14775]]
-** 950.677
+* [[RXN-14776]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-14778]]
-* [[RXN-902]]
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-14777 RXN-14777]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-14780 RXN-14780]
-{{#set: common-name=(e)-2-benzylidenesuccinyl-coa}}
+* [NoneRXN-14781 RXN-14781]
-{{#set: inchi-key=inchikey=cizckpngzpendv-umuuvtgisa-i}}
+* [NoneRXN-14779 RXN-14779]
-{{#set: molecular-weight=950.677}}
+* [NoneRXN-14773 RXN-14773]
+* [NoneRXN-14770 RXN-14770]
+{{#set: taxonomic-range=tax-4751}}
+{{#set: common-name=10-cis-heptadecenoyl-coa degradation (yeast)}}
+{{#set: nb reaction found=6}}
+{{#set: completion rate=0.5}}
+{{#set: nb total reaction=12}}