Difference between revisions of "PWY-7337"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] == * common-name: ** 2-methylbutanoyl-coa * smiles:...")
(Created page with "Category:pathway == Pathway PWY-7337 == * taxonomic-range: ** tax-4751 * common-name: ** 10-cis-heptadecenoyl-coa degradation (yeast) == Reaction(s) found == * RXN-14771...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] ==
+
== Pathway PWY-7337 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
−
** 2-methylbutanoyl-coa
+
** 10-cis-heptadecenoyl-coa degradation (yeast)
−
* smiles:
+
== Reaction(s) found ==
−
** ccc(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[RXN-14771]]
−
* inchi-key:
+
* [[RXN-14772]]
−
** lynvnydeqmmnmz-xgxnyeovsa-j
+
* [[RXN-14774]]
−
* molecular-weight:
+
* [[RXN-14775]]
−
** 847.62
+
* [[RXN-14776]]
−
== Reaction(s) known to consume the compound ==
+
* [[RXN-14778]]
−
* [[2-MEBUCOA-FAD-RXN]]
+
== Reaction(s) not found ==
−
* [[2KETO-3METHYLVALERATE-RXN]]
+
* [NoneRXN-14777 RXN-14777]
−
* [[MBCOA-DHLIPOAMIDE-RXN]]
+
* [NoneRXN-14780 RXN-14780]
−
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
+
* [NoneRXN-14781 RXN-14781]
−
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-14779 RXN-14779]
−
* [[2-MEBUCOA-FAD-RXN]]
+
* [NoneRXN-14773 RXN-14773]
−
* [[2KETO-3METHYLVALERATE-RXN]]
+
* [NoneRXN-14770 RXN-14770]
−
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
+
{{#set: taxonomic-range=tax-4751}}
−
* [[MBCOA-DHLIPOAMIDE-RXN]]
+
{{#set: common-name=10-cis-heptadecenoyl-coa degradation (yeast)}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=6}}
−
{{#set: common-name=2-methylbutanoyl-coa}}
+
{{#set: completion rate=0.5}}
−
{{#set: inchi-key=inchikey=lynvnydeqmmnmz-xgxnyeovsa-j}}
+
{{#set: nb total reaction=12}}
−
{{#set: molecular-weight=847.62}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7337

  • taxonomic-range:
    • tax-4751
  • common-name:
    • 10-cis-heptadecenoyl-coa degradation (yeast)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14777 RXN-14777]
  • [NoneRXN-14780 RXN-14780]
  • [NoneRXN-14781 RXN-14781]
  • [NoneRXN-14779 RXN-14779]
  • [NoneRXN-14773 RXN-14773]
  • [NoneRXN-14770 RXN-14770]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-7337&oldid=130489"