Difference between revisions of "PWY-7339"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] == * common-name: ** 7,8-dihydrolumazine * smiles: ** c2(=o)(c1(=c(ncc=n1)...")
(Created page with "Category:pathway == Pathway PWY-7339 == * taxonomic-range: ** tax-4751 * common-name: ** 10-trans-heptadecenoyl-coa degradation (mfe-dependent, yeast) == Reaction(s) found...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16458 CPD-16458] ==
+
== Pathway PWY-7339 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** 7,8-dihydrolumazine
+
** 10-trans-heptadecenoyl-coa degradation (mfe-dependent, yeast)
* smiles:
+
== Reaction(s) found ==
** c2(=o)(c1(=c(ncc=n1)nc(=o)n2))
+
* [[RXN-14791]]
* inchi-key:
+
* [[RXN-14793]]
** myjneehzesremo-uhfffaoysa-n
+
* [[RXN-14794]]
* molecular-weight:
+
== Reaction(s) not found ==
** 166.139
+
* [NoneRXN-14792 RXN-14792]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-14780 RXN-14780]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-14781 RXN-14781]
* [[RXN-15261]]
+
{{#set: taxonomic-range=tax-4751}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=10-trans-heptadecenoyl-coa degradation (mfe-dependent, yeast)}}
{{#set: common-name=7,8-dihydrolumazine}}
+
{{#set: nb reaction found=3}}
{{#set: inchi-key=inchikey=myjneehzesremo-uhfffaoysa-n}}
+
{{#set: completion rate=0.5}}
{{#set: molecular-weight=166.139}}
+
{{#set: nb total reaction=6}}

Latest revision as of 11:00, 18 March 2021

Pathway PWY-7339

  • taxonomic-range:
    • tax-4751
  • common-name:
    • 10-trans-heptadecenoyl-coa degradation (mfe-dependent, yeast)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14792 RXN-14792]
  • [NoneRXN-14780 RXN-14780]
  • [NoneRXN-14781 RXN-14781]