Difference between revisions of "PWY-7342"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRINOGEN PROTOPORPHYRINOGEN] ==
+== Pathway LCYSDEG-PWY ==
+* taxonomic-range:
+** tax-2
+** tax-2759
 * common-name:
-** protoporphyrinogen ix
+** l-cysteine degradation ii
-* smiles:
+== Reaction(s) found ==
-** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
+* [[RXN-15129]]
-* inchi-key:
+== Reaction(s) not found ==
-** uhsgpdmiqqynax-uhfffaoysa-l
+* [NoneRXN-15127 RXN-15127]
-* molecular-weight:
+* [NoneRXN-15124 RXN-15124]
-** 566.699
+{{#set: taxonomic-range=tax-2|tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-cysteine degradation ii}}
-* [[PPPGO]]
+{{#set: nb reaction found=1}}
-* [[PROTOPORGENOXI-RXN]]
+{{#set: completion rate=0.33}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=3}}
-* [[HEMN-RXN]]
-* [[RXN0-1461]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=protoporphyrinogen ix}}
-{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
-{{#set: molecular-weight=566.699}}