Difference between revisions of "PWY-7346"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] == * common-name: ** β-carotene * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINE NIACINE] == * common-name: ** nicotinate * smiles: ** c1(=cc=c(c([o-])=o)c=n1) * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINE NIACINE] ==
 
* common-name:
 
* common-name:
** β-carotene
+
** nicotinate
 
* smiles:
 
* smiles:
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
+
** c1(=cc=c(c([o-])=o)c=n1)
 
* inchi-key:
 
* inchi-key:
** oenhqhleoonyie-jltxgrslsa-n
+
** pvniimvlhyawgp-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 536.882
+
** 122.103
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13641]]
+
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
* [[RXN-8025]]
 
* [[RXN1F-152]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13641]]
 
* [[RXN1F-151]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-carotene}}
+
{{#set: common-name=nicotinate}}
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}
+
{{#set: inchi-key=inchikey=pvniimvlhyawgp-uhfffaoysa-m}}
{{#set: molecular-weight=536.882}}
+
{{#set: molecular-weight=122.103}}

Revision as of 09:22, 27 August 2019

Metabolite NIACINE

  • common-name:
    • nicotinate
  • smiles:
    • c1(=cc=c(c([o-])=o)c=n1)
  • inchi-key:
    • pvniimvlhyawgp-uhfffaoysa-m
  • molecular-weight:
    • 122.103

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality