Difference between revisions of "PWY-7346"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * smiles: ** cc(c)(c(o)c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] == * common-name: ** β-carotene * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] ==
 
* common-name:
 
* common-name:
** 4-hydroxybenzoyl-acetyl-coa
+
** β-carotene
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
 
* inchi-key:
 
* inchi-key:
** ovqojjjxnyhopr-fueukbnzsa-j
+
** oenhqhleoonyie-jltxgrslsa-n
 
* molecular-weight:
 
* molecular-weight:
** 925.647
+
** 536.882
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11246]]
+
* [[RXN-13641]]
 +
* [[RXN-8025]]
 +
* [[RXN1F-152]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11245]]
+
* [[RXN-13641]]
 +
* [[RXN1F-151]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxybenzoyl-acetyl-coa}}
+
{{#set: common-name=β-carotene}}
{{#set: inchi-key=inchikey=ovqojjjxnyhopr-fueukbnzsa-j}}
+
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}
{{#set: molecular-weight=925.647}}
+
{{#set: molecular-weight=536.882}}

Revision as of 14:19, 26 August 2019

Metabolite CPD1F-129

  • common-name:
    • β-carotene
  • smiles:
    • cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
  • inchi-key:
    • oenhqhleoonyie-jltxgrslsa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality