Difference between revisions of "PWY-7351"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alcohols Alcohols] == * common-name: ** an alcohol == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == * common-name: ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17814 CPD-17814] == |
* common-name: | * common-name: | ||
− | ** | + | ** (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa |
+ | * smiles: | ||
+ | ** ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o | ||
+ | * inchi-key: | ||
+ | ** shgdvnglfxviak-bfvorphasa-j | ||
+ | * molecular-weight: | ||
+ | ** 1015.898 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16559]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16558]] |
− | + | * [[RXN-16559]] | |
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(11z)-(s)-3-hydroxyhexadec-11-enoyl-coa}} |
+ | {{#set: inchi-key=inchikey=shgdvnglfxviak-bfvorphasa-j}} | ||
+ | {{#set: molecular-weight=1015.898}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-17814
- common-name:
- (11z)-(s)-3-hydroxyhexadec-11-enoyl-coa
- smiles:
- ccccc=ccccccccc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
- inchi-key:
- shgdvnglfxviak-bfvorphasa-j
- molecular-weight:
- 1015.898