Difference between revisions of "PWY-7356"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] ==
+== Pathway PWY-7356 ==
+* taxonomic-range:
+** tax-2
+** tax-4751
 * common-name:
-** &beta;-d-cellobiose
+** thiamine salvage iv (yeast)
-* smiles:
+== Reaction(s) found ==
-** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
+* [[OHMETPYRKIN-RXN]]
-* inchi-key:
+* [[PYRIMSYN3-RXN]]
-** gubgytabksrvrq-qrzgkkjrsa-n
+* [[THI-P-SYN-RXN]]
-* molecular-weight:
+* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
-** 342.299
+* [[THIAMINASE-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[THIAZOLSYN3-RXN]]
-* [[RXN-10773]]
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXNQT-4191 RXNQT-4191]
-* [[3.2.1.91-RXN]]
+{{#set: taxonomic-range=tax-4751|tax-2}}
-* [[RXN-12305]]
+{{#set: common-name=thiamine salvage iv (yeast)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=6}}
-{{#set: common-name=&beta;-d-cellobiose}}
+{{#set: completion rate=0.86}}
-{{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}}
+{{#set: nb total reaction=7}}
-{{#set: molecular-weight=342.299}}