Difference between revisions of "PWY-7357"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] ==
+== Pathway PWY-7357 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** (s)-3-hydroxy-(7z)-tetradecenoyl-coa
+** thiamine formation from pyrithiamine and oxythiamine (yeast)
-* smiles:
+== Reaction(s) found ==
-** ccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[OHMETPYRKIN-RXN]]
-* inchi-key:
+* [[PYRIMSYN3-RXN]]
-** wgcarzjtijiwsl-jcjyipitsa-j
+* [[THI-P-SYN-RXN]]
-* molecular-weight:
+* [[THIAZOLSYN3-RXN]]
-** 987.845
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-14857 RXN-14857]
-* [[RXN-17794]]
+* [NoneRXN-14858 RXN-14858]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-4751}}
-* [[RXN-17793]]
+{{#set: common-name=thiamine formation from pyrithiamine and oxythiamine (yeast)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=4}}
-{{#set: common-name=(s)-3-hydroxy-(7z)-tetradecenoyl-coa}}
+{{#set: completion rate=0.67}}
-{{#set: inchi-key=inchikey=wgcarzjtijiwsl-jcjyipitsa-j}}
+{{#set: nb total reaction=6}}
-{{#set: molecular-weight=987.845}}