Difference between revisions of "PWY-7357"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] == * common-name: ** (s)-3-hydroxy-(7z)-tetradecenoyl-coa * smiles: ** ccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=b-Hydroxy-cis-D5-dodecenoyl-ACPs b-Hydroxy-cis-D5-dodecenoyl-ACPs] == * common-name: ** a (3r,5...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19154 CPD-19154] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=b-Hydroxy-cis-D5-dodecenoyl-ACPs b-Hydroxy-cis-D5-dodecenoyl-ACPs] ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(7z)-tetradecenoyl-coa
+
** a (3r,5z)-3-hydroxy-dodec-5-enoyl-[acp]
* smiles:
 
** ccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wgcarzjtijiwsl-jcjyipitsa-j
 
* molecular-weight:
 
** 987.845
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17794]]
+
* [[RXN0-2144]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17793]]
+
* [[RXN0-2142]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(7z)-tetradecenoyl-coa}}
+
{{#set: common-name=a (3r,5z)-3-hydroxy-dodec-5-enoyl-[acp]}}
{{#set: inchi-key=inchikey=wgcarzjtijiwsl-jcjyipitsa-j}}
 
{{#set: molecular-weight=987.845}}
 

Revision as of 09:22, 27 August 2019

Metabolite b-Hydroxy-cis-D5-dodecenoyl-ACPs

  • common-name:
    • a (3r,5z)-3-hydroxy-dodec-5-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r,5z)-3-hydroxy-dodec-5-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.