Difference between revisions of "PWY-7377"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-threonyl-Protein L-methionyl-L-threonyl-Protein] == * common-name: ** an n-termin...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] == * common-name: ** 12-oxo-cis-10,15-phytodienoate * smiles: ** ccc=ccc1(c(c=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 12-oxo-cis-10,15-phytodienoate |
| + | * smiles: | ||
| + | ** ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** pmtmafaplcgxgk-jmtmcxqrsa-m | ||
| + | * molecular-weight: | ||
| + | ** 291.409 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=12-oxo-cis-10,15-phytodienoate}} |
| + | {{#set: inchi-key=inchikey=pmtmafaplcgxgk-jmtmcxqrsa-m}} | ||
| + | {{#set: molecular-weight=291.409}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-729
- common-name:
- 12-oxo-cis-10,15-phytodienoate
- smiles:
- ccc=ccc1(c(c=cc(=o)1)cccccccc([o-])=o)
- inchi-key:
- pmtmafaplcgxgk-jmtmcxqrsa-m
- molecular-weight:
- 291.409
