Difference between revisions of "PWY-7379"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] ==
+== Pathway PWY-7379 ==
+* taxonomic-range:
+** tax-10239
+** tax-33208
 * common-name:
-** demethylmenaquinol-7
+** mrna capping ii
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+* [[2.1.1.57-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ufzdimbxtvrbds-ssqlmynasa-n
+* [NoneRXN-14928 RXN-14928]
-* molecular-weight:
+{{#set: taxonomic-range=tax-33208|tax-10239}}
-** 636.999
+{{#set: common-name=mrna capping ii}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-9191]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=demethylmenaquinol-7}}
-{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
-{{#set: molecular-weight=636.999}}