Difference between revisions of "PWY-7379"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] ==
+== Pathway PWY-6133 ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** demethylmenaquinol-7
+** (s)-reticuline biosynthesis ii
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+* [[RXN-5861]]
-* inchi-key:
+* [[TYROSINE-DECARBOXYLASE-RXN]]
-** ufzdimbxtvrbds-ssqlmynasa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-9981 RXN-9981]
-** 636.999
+* [NoneRXN-9980 RXN-9980]
-== Reaction(s) known to consume the compound ==
+* [None2.6.1.49-RXN 2.6.1.49-RXN]
-* [[RXN-9191]]
+* [NoneRXN-9979 RXN-9979]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-9978 RXN-9978]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-40674}}
-{{#set: common-name=demethylmenaquinol-7}}
+{{#set: common-name=(s)-reticuline biosynthesis ii}}
-{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
+{{#set: nb reaction found=2}}
-{{#set: molecular-weight=636.999}}
+{{#set: completion rate=0.29}}
+{{#set: nb total reaction=7}}