Difference between revisions of "PWY-7380"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] ==
+== Pathway PWY-7380 ==
+* taxonomic-range:
+** tax-1239
 * common-name:
-** 2-oxoadipate
+** biotin biosynthesis from 8-amino-7-oxononanoate ii
-* smiles:
+== Reaction(s) found ==
-** c(cc(=o)c(=o)[o-])cc(=o)[o-]
+* [[2.8.1.6-RXN]]
-* inchi-key:
+* [[DETHIOBIOTIN-SYN-RXN]]
-** fgsbnbbhozhubo-uhfffaoysa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-14930 RXN-14930]
-** 158.11
+{{#set: taxonomic-range=tax-1239}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=biotin biosynthesis from 8-amino-7-oxononanoate ii}}
-* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=2-oxoadipate}}
-{{#set: inchi-key=inchikey=fgsbnbbhozhubo-uhfffaoysa-l}}
-{{#set: molecular-weight=158.11}}