Difference between revisions of "PWY-7380"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] ==
 * common-name:
-** &beta;-d-glucose 6-phosphate
+** 4-amino-4-deoxychorismate
 * smiles:
-** c(c1(oc(c(c(c1o)o)o)o))op([o-])([o-])=o
+** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1)
 * inchi-key:
-** nbschqhzlsjfnq-vfuothlcsa-l
+** oiujhgolfkdbsu-htqzyqbosa-m
 * molecular-weight:
-** 258.121
+** 224.193
 == Reaction(s) known to consume the compound ==
-* [[G6PBDH]]
+* [[ADCLY-RXN]]
-* [[G6PBDHh]]
+* [[PABASYN-RXN]]
-* [[G6PI]]
-* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
-* [[PGIB]]
-* [[PGIBh]]
-* [[RXN66-579]]
 == Reaction(s) known to produce the compound ==
-* [[G6PI]]
+* [[ADCLY-RXN]]
-* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
+* [[PABASYN-RXN]]
-* [[PGIB]]
-* [[PGIBh]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=&beta;-d-glucose 6-phosphate}}
+{{#set: common-name=4-amino-4-deoxychorismate}}
-{{#set: inchi-key=inchikey=nbschqhzlsjfnq-vfuothlcsa-l}}
+{{#set: inchi-key=inchikey=oiujhgolfkdbsu-htqzyqbosa-m}}
-{{#set: molecular-weight=258.121}}
+{{#set: molecular-weight=224.193}}