Difference between revisions of "PWY-7382"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * common-name: ** d-galactosylononitol * smiles: ** coc1(c(c(c(c(c1o)o)o)...")
 
(Created page with "Category:pathway == Pathway PWY-7382 == * taxonomic-range: ** tax-4751 * common-name: ** lipoate biosynthesis and incorporation (yeast) == Reaction(s) found == * RXN-130...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] ==
+
== Pathway PWY-7382 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** d-galactosylononitol
+
** lipoate biosynthesis and incorporation (yeast)
* smiles:
+
== Reaction(s) found ==
** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
+
* [[RXN-13037]]
* inchi-key:
+
* [[RXN-14950]]
** rsyncmydvzfzbp-nrorzaabsa-n
+
* [[RXN-14957]]
* molecular-weight:
+
* [[RXN-14959]]
** 356.326
+
== Reaction(s) not found ==
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-14954 RXN-14954]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-14958 RXN-14958]
* [[RXN-8281]]
+
* [NoneRXN-14955 RXN-14955]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-4751}}
{{#set: common-name=d-galactosylononitol}}
+
{{#set: common-name=lipoate biosynthesis and incorporation (yeast)}}
{{#set: inchi-key=inchikey=rsyncmydvzfzbp-nrorzaabsa-n}}
+
{{#set: nb reaction found=4}}
{{#set: molecular-weight=356.326}}
+
{{#set: completion rate=0.57}}
 +
{{#set: nb total reaction=7}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-7382

  • taxonomic-range:
    • tax-4751
  • common-name:
    • lipoate biosynthesis and incorporation (yeast)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14954 RXN-14954]
  • [NoneRXN-14958 RXN-14958]
  • [NoneRXN-14955 RXN-14955]