Difference between revisions of "PWY-7384"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * common-name: ** o-sinapoylcholine * smiles: ** c(coc(...")
(Created page with "Category:pathway == Pathway PWY-7384 == * taxonomic-range: ** tax-6231 ** tax-6157 ** tax-6340 ** tax-6447 * common-name: ** anaerobic energy metabolism (invertebrates, mi...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] ==
+
== Pathway PWY-7384 ==
 +
* taxonomic-range:
 +
** tax-6231
 +
** tax-6157
 +
** tax-6340
 +
** tax-6447
 
* common-name:
 
* common-name:
** o-sinapoylcholine
+
** anaerobic energy metabolism (invertebrates, mitochondrial)
* smiles:
+
== Reaction(s) found ==
** c(coc(=o)c=cc1(c=c(oc)c(o)=c(c=1)oc))[n+](c)(c)c
+
* [[1.1.1.39-RXN]]
* inchi-key:
+
* [[FUMHYDR-RXN]]
** hujxhfrxwwgyqh-uhfffaoysa-o
+
* [[PROPIONYL-COA-CARBOXY-RXN]]
* molecular-weight:
+
* [[PYRUVDEH-RXN]]
** 310.369
+
* [[SUCCCOASYN-RXN]]
== Reaction(s) known to consume the compound ==
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-8807 RXN-8807]
* [[2.3.1.91-RXN]]
+
* [NoneRXN0-268 RXN0-268]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-14963 RXN-14963]
{{#set: common-name=o-sinapoylcholine}}
+
* [NoneMETHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN]
{{#set: inchi-key=inchikey=hujxhfrxwwgyqh-uhfffaoysa-o}}
+
* [NoneMETHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN]
{{#set: molecular-weight=310.369}}
+
{{#set: taxonomic-range=tax-6447|tax-6231|tax-6340|tax-6157}}
 +
{{#set: common-name=anaerobic energy metabolism (invertebrates, mitochondrial)}}
 +
{{#set: nb reaction found=5}}
 +
{{#set: completion rate=0.5}}
 +
{{#set: nb total reaction=10}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7384

  • taxonomic-range:
    • tax-6231
    • tax-6157
    • tax-6340
    • tax-6447
  • common-name:
    • anaerobic energy metabolism (invertebrates, mitochondrial)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-8807 RXN-8807]
  • [NoneRXN0-268 RXN0-268]
  • [NoneRXN-14963 RXN-14963]
  • [NoneMETHYLMALONYL-COA-EPIM-RXN METHYLMALONYL-COA-EPIM-RXN]
  • [NoneMETHYLMALONYL-COA-MUT-RXN METHYLMALONYL-COA-MUT-RXN]