Difference between revisions of "PWY-7394"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRULOSE D-ERYTHRULOSE] == * common-name: ** d-erythrulose * smiles: ** c(o)c(o)c(=o)co *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18447 CPD-18447] == * common-name: ** actinocin * smiles: ** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18447 CPD-18447] == |
* common-name: | * common-name: | ||
| − | ** | + | ** actinocin |
* smiles: | * smiles: | ||
| − | ** c(o)c(o)c(=o) | + | ** cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kxrmrepjuitwdu-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 326.265 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-17077]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-17077]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=actinocin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kxrmrepjuitwdu-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=326.265}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-18447
- common-name:
- actinocin
- smiles:
- cc1(=cc=c(c(=o)[o-])c2(n=c3(c(oc1=2)=c(c)c(=o)c(n)=c(c(=o)[o-])3)))
- inchi-key:
- kxrmrepjuitwdu-uhfffaoysa-l
- molecular-weight:
- 326.265
