Difference between revisions of "PWY-7397"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] ==
+== Pathway PWY-7397 ==
+* taxonomic-range:
+** tax-4751
+** tax-33090
 * common-name:
-** phenylacetyl-coa
+** naringenin biosynthesis (engineered)
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[4-COUMARATE--COA-LIGASE-RXN]]
-* inchi-key:
+* [[APIGNAR-RXN]]
-** zigifdrjfzyeeq-cecatxlmsa-j
+* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 881.637
+* [NoneRXN-9697 RXN-9697]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-4751|tax-33090}}
-* [[RXN-10821]]
+{{#set: common-name=naringenin biosynthesis (engineered)}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=3}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.75}}
-{{#set: common-name=phenylacetyl-coa}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}}
-{{#set: molecular-weight=881.637}}