Difference between revisions of "PWY-7410"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11647 CPD-11647] ==
+== Pathway PWY-7820 ==
+* taxonomic-range:
+** tax-1239
 * common-name:
-** thermospermine
+** teichuronic acid biosynthesis (b. subtilis 168)
-* smiles:
+== Reaction(s) found ==
-** c([n+])ccc[n+]ccc[n+]ccc[n+]
+* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
-* inchi-key:
+* [[UGD-RXN]]
-** doddbcgmrafleb-uhfffaoysa-r
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-14571 RXN-14571]
-** 206.374
+* [NoneTRANS-RXN-322 TRANS-RXN-322]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18065 RXN-18065]
-* [[RXN-11190]]
+* [NoneRXN-18066 RXN-18066]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-18063 RXN-18063]
-* [[RXN-11190]]
+* [NoneRXN-18064 RXN-18064]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-18067 RXN-18067]
-{{#set: common-name=thermospermine}}
+{{#set: taxonomic-range=tax-1239}}
-{{#set: inchi-key=inchikey=doddbcgmrafleb-uhfffaoysa-r}}
+{{#set: common-name=teichuronic acid biosynthesis (b. subtilis 168)}}
-{{#set: molecular-weight=206.374}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.22}}
+{{#set: nb total reaction=9}}