Difference between revisions of "PWY-7411"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8999 CPD-8999] ==
+== Pathway PWY-7411 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
+** phosphatidate biosynthesis (yeast)
-* smiles:
+== Reaction(s) found ==
-** csccc(=o)c(=o)cop([o-])(=o)[o-]
+* [[1.1.1.8-RXN]]
-* inchi-key:
+* [[RXN-15043]]
-** hkeaovfnwrdvaj-uhfffaoysa-l
+* [[RXN-15044]]
-* molecular-weight:
+* [[RXN-15045]]
-** 240.167
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-15046 RXN-15046]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2759}}
-* [[R145-RXN]]
+{{#set: common-name=phosphatidate biosynthesis (yeast)}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=4}}
-{{#set: common-name=5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate}}
+{{#set: completion rate=0.8}}
-{{#set: inchi-key=inchikey=hkeaovfnwrdvaj-uhfffaoysa-l}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=240.167}}