Difference between revisions of "PWY-7413"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-containing-5Me-uridine54 tRNA-containing-5Me-uridine54] == * common-name: ** a 5-methylura...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * common-name: ** myricetin * smiles: ** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == |
* common-name: | * common-name: | ||
| − | ** | + | ** myricetin |
| + | * smiles: | ||
| + | ** c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3))) | ||
| + | * inchi-key: | ||
| + | ** ikmdfbphznjcsn-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 317.231 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8450]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=myricetin}} |
| + | {{#set: inchi-key=inchikey=ikmdfbphznjcsn-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=317.231}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite MYRICETIN
- common-name:
- myricetin
- smiles:
- c1(c(o)=c(o)c(o)=cc=1c2(oc3(c=c(o)c=c(o)c(c(=o)c([o-])=2)=3)))
- inchi-key:
- ikmdfbphznjcsn-uhfffaoysa-m
- molecular-weight:
- 317.231
