Difference between revisions of "PWY-7417"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Heparan-NAc-Glc-6S Heparan-NAc-Glc-6S] == * common-name: ** [heparan sulfate]-α-n-acetyl-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * common-name: ** 3-isopropyl-8-(methylthio)-2-oxooctanoate * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-isopropyl-8-(methylthio)-2-oxooctanoate |
| + | * smiles: | ||
| + | ** cscccccc(c(=o)c(=o)[o-])c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** yobcouzbifvtfn-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 246.278 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18204]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18204]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-isopropyl-8-(methylthio)-2-oxooctanoate}} |
| + | {{#set: inchi-key=inchikey=yobcouzbifvtfn-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=246.278}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-19489
- common-name:
- 3-isopropyl-8-(methylthio)-2-oxooctanoate
- smiles:
- cscccccc(c(=o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- yobcouzbifvtfn-uhfffaoysa-l
- molecular-weight:
- 246.278
