Difference between revisions of "PWY-7417"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] ==
+== Pathway PWY66-201 ==
+* taxonomic-range:
+** tax-40674
 * common-name:
-** 3-isopropyl-8-(methylthio)-2-oxooctanoate
+** nicotine degradation iv
-* smiles:
+== Reaction(s) found ==
-** cscccccc(c(=o)c(=o)[o-])c(=o)[o-]
+* [[RXN66-146]]
-* inchi-key:
+* [[RXN66-81]]
-** yobcouzbifvtfn-uhfffaoysa-l
+* [[RXN66-83]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 246.278
+* [NoneRXN-13089 RXN-13089]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN66-105 RXN66-105]
-* [[RXN-18204]]
+* [NoneRXN66-142 RXN66-142]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN66-101 RXN66-101]
-* [[RXN-18204]]
+* [NoneRXN-13088 RXN-13088]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN66-144 RXN66-144]
-{{#set: common-name=3-isopropyl-8-(methylthio)-2-oxooctanoate}}
+* [NoneRXN66-62 RXN66-62]
-{{#set: inchi-key=inchikey=yobcouzbifvtfn-uhfffaoysa-l}}
+* [NoneRXN66-141 RXN66-141]
-{{#set: molecular-weight=246.278}}
+* [NoneRXN66-103 RXN66-103]
+* [NoneRXN66-145 RXN66-145]
+* [NoneRXN66-61 RXN66-61]
+* [NoneRXN66-147 RXN66-147]
+* [NoneRXN66-104 RXN66-104]
+{{#set: taxonomic-range=tax-40674}}
+{{#set: common-name=nicotine degradation iv}}
+{{#set: nb reaction found=3}}
+{{#set: completion rate=0.19}}
+{{#set: nb total reaction=16}}