Difference between revisions of "PWY-7420"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] == * common-name: ** (e)-2-benzylidenesuccinyl-coa *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycerolipids Glycerolipids] == * common-name: ** a glycerolipid == Reaction(s) known to consum...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycerolipids Glycerolipids] ==
 
* common-name:
 
* common-name:
** (e)-2-benzylidenesuccinyl-coa
+
** a glycerolipid
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** cizckpngzpendv-umuuvtgisa-i
 
* molecular-weight:
 
** 950.677
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-902]]
+
* [[RXN-16042]]
 +
* [[RXN-16044]]
 +
* [[RXN-16150]]
 +
* [[RXN-16151]]
 +
* [[RXN-16152]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-17688]]
 +
* [[RXN-9670]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16041]]
 +
* [[RXN-16043]]
 +
* [[RXN-16045]]
 +
* [[RXN-16138]]
 +
* [[RXN-16139]]
 +
* [[RXN-16150]]
 +
* [[RXN-16151]]
 +
* [[RXN-16157]]
 +
* [[RXN-16158]]
 +
* [[RXN-17688]]
 +
* [[RXN-9670]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-2-benzylidenesuccinyl-coa}}
+
{{#set: common-name=a glycerolipid}}
{{#set: inchi-key=inchikey=cizckpngzpendv-umuuvtgisa-i}}
 
{{#set: molecular-weight=950.677}}
 

Revision as of 14:18, 26 August 2019