Difference between revisions of "PWY-7424"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
+== Pathway PWY-7424 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** delphinidin 3,5-di-o-&beta;-d-glucoside
+** sterol:steryl ester interconversion (yeast)
-* smiles:
+== Reaction(s) found ==
-** c(o)c1(c(o)c(o)c(o)c(o1)oc5(c4(c=c(oc2(c(o)c(o)c(o)c(co)o2))c(c3(c=c(o)c(o)=c(o)c=3))=[o+]c=4c=c([o-])c=5)))
+* [[RXN-15133]]
-* inchi-key:
+* [[RXN-15135]]
-** xctgxgvgjyacei-lcenjuansa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-15132 RXN-15132]
-** 626.524
+* [NoneRXN-15134 RXN-15134]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2759}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=sterol:steryl ester interconversion (yeast)}}
-* [[RXN-8228]]
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.5}}
-{{#set: common-name=delphinidin 3,5-di-o-&beta;-d-glucoside}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=xctgxgvgjyacei-lcenjuansa-n}}
-{{#set: molecular-weight=626.524}}